C12H13I2NO5 — CID 103153358
4-[(2-hydroxy-3,5-diiodobenzoyl)amino]-3-methoxybutanoic acid (PubChem CID 103153358) has the molecular formula C12H13I2NO5 and a molecular weight of 505.05 g/mol. Its IUPAC name is 4-[(2-hydroxy-3,5-diiodobenzoyl)amino]-3-methoxybutanoic acid.
| Compound Name | 4-[(2-hydroxy-3,5-diiodobenzoyl)amino]-3-methoxybutanoic acid |
|---|---|
| PubChem CID | 103153358 |
| Molecular Formula | C12H13I2NO5 |
| Molecular Weight | 505.05 g/mol |
| Exact Mass | 504.89 |
| IUPAC Name | 4-[(2-hydroxy-3,5-diiodobenzoyl)amino]-3-methoxybutanoic acid |
| SMILES | COC(CNC(=O)c1cc(I)cc(I)c1O)CC(=O)O |
| InChI | InChI=1S/C12H13I2NO5/c1-20-7(4-10(16)17)5-15-12(19)8-2-6(13)3-9(14)11(8)18/h2-3,7,18H,4-5H2,1H3,(H,15,19)(H,16,17) |
| InChIKey | XXBAHCVSVLECOL-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.05 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|