C12H13I2NO4 — CID 80538597
4-[(2-hydroxy-3,5-diiodobenzoyl)amino]-2-methylbutanoic acid (PubChem CID 80538597) has the molecular formula C12H13I2NO4 and a molecular weight of 489.05 g/mol. Its IUPAC name is 4-[(2-hydroxy-3,5-diiodobenzoyl)amino]-2-methylbutanoic acid.
| Compound Name | 4-[(2-hydroxy-3,5-diiodobenzoyl)amino]-2-methylbutanoic acid |
|---|---|
| PubChem CID | 80538597 |
| Molecular Formula | C12H13I2NO4 |
| Molecular Weight | 489.05 g/mol |
| Exact Mass | 488.89 |
| IUPAC Name | 4-[(2-hydroxy-3,5-diiodobenzoyl)amino]-2-methylbutanoic acid |
| SMILES | CC(CCNC(=O)c1cc(I)cc(I)c1O)C(=O)O |
| InChI | InChI=1S/C12H13I2NO4/c1-6(12(18)19)2-3-15-11(17)8-4-7(13)5-9(14)10(8)16/h4-6,16H,2-3H2,1H3,(H,15,17)(H,18,19) |
| InChIKey | FDBXQTUEAWSZEL-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.05 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|