C12H12F3NO4 — CID 80538589
2-methyl-4-[(2,4,5-trifluoro-3-hydroxybenzoyl)amino]butanoic acid (PubChem CID 80538589) has the molecular formula C12H12F3NO4 and a molecular weight of 291.23 g/mol. Its IUPAC name is 2-methyl-4-[(2,4,5-trifluoro-3-hydroxybenzoyl)amino]butanoic acid.
| Compound Name | 2-methyl-4-[(2,4,5-trifluoro-3-hydroxybenzoyl)amino]butanoic acid |
|---|---|
| PubChem CID | 80538589 |
| Molecular Formula | C12H12F3NO4 |
| Molecular Weight | 291.23 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | 2-methyl-4-[(2,4,5-trifluoro-3-hydroxybenzoyl)amino]butanoic acid |
| SMILES | CC(CCNC(=O)c1cc(F)c(F)c(O)c1F)C(=O)O |
| InChI | InChI=1S/C12H12F3NO4/c1-5(12(19)20)2-3-16-11(18)6-4-7(13)9(15)10(17)8(6)14/h4-5,17H,2-3H2,1H3,(H,16,18)(H,19,20) |
| InChIKey | DFRIUAOPJZHGEG-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.23 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|