C9H8F3NO3 — CID 43501008
2,4,5-trifluoro-3-hydroxy-N-(2-hydroxyethyl)benzamide (PubChem CID 43501008) has the molecular formula C9H8F3NO3 and a molecular weight of 235.16 g/mol. Its IUPAC name is 2,4,5-trifluoro-3-hydroxy-N-(2-hydroxyethyl)benzamide.
| Compound Name | 2,4,5-trifluoro-3-hydroxy-N-(2-hydroxyethyl)benzamide |
|---|---|
| PubChem CID | 43501008 |
| Molecular Formula | C9H8F3NO3 |
| Molecular Weight | 235.16 g/mol |
| Exact Mass | 235.05 |
| IUPAC Name | 2,4,5-trifluoro-3-hydroxy-N-(2-hydroxyethyl)benzamide |
| SMILES | O=C(NCCO)c1cc(F)c(F)c(O)c1F |
| InChI | InChI=1S/C9H8F3NO3/c10-5-3-4(9(16)13-1-2-14)6(11)8(15)7(5)12/h3,14-15H,1-2H2,(H,13,16) |
| InChIKey | GGELKYWKXPIUKV-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.16 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|