C14H17F3N2O2 — CID 106124653
N-[(4-aminocyclohexyl)methyl]-2,4,5-trifluoro-3-hydroxybenzamide (PubChem CID 106124653) has the molecular formula C14H17F3N2O2 and a molecular weight of 302.30 g/mol. Its IUPAC name is N-[(4-aminocyclohexyl)methyl]-2,4,5-trifluoro-3-hydroxybenzamide.
| Compound Name | N-[(4-aminocyclohexyl)methyl]-2,4,5-trifluoro-3-hydroxybenzamide |
|---|---|
| PubChem CID | 106124653 |
| Molecular Formula | C14H17F3N2O2 |
| Molecular Weight | 302.30 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | N-[(4-aminocyclohexyl)methyl]-2,4,5-trifluoro-3-hydroxybenzamide |
| SMILES | NC1CCC(CNC(=O)c2cc(F)c(F)c(O)c2F)CC1 |
| InChI | InChI=1S/C14H17F3N2O2/c15-10-5-9(11(16)13(20)12(10)17)14(21)19-6-7-1-3-8(18)4-2-7/h5,7-8,20H,1-4,6,18H2,(H,19,21) |
| InChIKey | HYKFPDNTCWIHQP-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.30 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|