C14H18F2N2O — CID 106124024
N-[(4-aminocyclohexyl)methyl]-2,6-difluorobenzamide (PubChem CID 106124024) has the molecular formula C14H18F2N2O and a molecular weight of 268.31 g/mol. Its IUPAC name is N-[(4-aminocyclohexyl)methyl]-2,6-difluorobenzamide.
| Compound Name | N-[(4-aminocyclohexyl)methyl]-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 106124024 |
| Molecular Formula | C14H18F2N2O |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | N-[(4-aminocyclohexyl)methyl]-2,6-difluorobenzamide |
| SMILES | NC1CCC(CNC(=O)c2c(F)cccc2F)CC1 |
| InChI | InChI=1S/C14H18F2N2O/c15-11-2-1-3-12(16)13(11)14(19)18-8-9-4-6-10(17)7-5-9/h1-3,9-10H,4-8,17H2,(H,18,19) |
| InChIKey | KNCFPSSPIQWXAS-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |