C18H24F2N2O — CID 16895608
N-[(1-cyclopentylpiperidin-4-yl)methyl]-2,6-difluorobenzamide (PubChem CID 16895608) has the molecular formula C18H24F2N2O and a molecular weight of 322.40 g/mol. Its IUPAC name is N-[(1-cyclopentylpiperidin-4-yl)methyl]-2,6-difluorobenzamide.
| Compound Name | N-[(1-cyclopentylpiperidin-4-yl)methyl]-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 16895608 |
| Molecular Formula | C18H24F2N2O |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | N-[(1-cyclopentylpiperidin-4-yl)methyl]-2,6-difluorobenzamide |
| SMILES | O=C(NCC1CCN(C2CCCC2)CC1)c1c(F)cccc1F |
| InChI | InChI=1S/C18H24F2N2O/c19-15-6-3-7-16(20)17(15)18(23)21-12-13-8-10-22(11-9-13)14-4-1-2-5-14/h3,6-7,13-14H,1-2,4-5,8-12H2,(H,21,23) |
| InChIKey | XBOFDAVKMRFTSF-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |