C10H10F3NO4 — CID 82722465
2,4,5-trifluoro-3-hydroxy-N-(2-methoxyethoxy)benzamide (PubChem CID 82722465) has the molecular formula C10H10F3NO4 and a molecular weight of 265.19 g/mol. Its IUPAC name is 2,4,5-trifluoro-3-hydroxy-N-(2-methoxyethoxy)benzamide.
| Compound Name | 2,4,5-trifluoro-3-hydroxy-N-(2-methoxyethoxy)benzamide |
|---|---|
| PubChem CID | 82722465 |
| Molecular Formula | C10H10F3NO4 |
| Molecular Weight | 265.19 g/mol |
| Exact Mass | 265.06 |
| IUPAC Name | 2,4,5-trifluoro-3-hydroxy-N-(2-methoxyethoxy)benzamide |
| SMILES | COCCONC(=O)c1cc(F)c(F)c(O)c1F |
| InChI | InChI=1S/C10H10F3NO4/c1-17-2-3-18-14-10(16)5-4-6(11)8(13)9(15)7(5)12/h4,15H,2-3H2,1H3,(H,14,16) |
| InChIKey | NVGYQKGFWFLRRY-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.19 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|