C10H11F3N2O2 — CID 63731123
N-(1-aminopropan-2-yl)-2,4,5-trifluoro-3-hydroxybenzamide (PubChem CID 63731123) has the molecular formula C10H11F3N2O2 and a molecular weight of 248.20 g/mol. Its IUPAC name is N-(1-aminopropan-2-yl)-2,4,5-trifluoro-3-hydroxybenzamide.
| Compound Name | N-(1-aminopropan-2-yl)-2,4,5-trifluoro-3-hydroxybenzamide |
|---|---|
| PubChem CID | 63731123 |
| Molecular Formula | C10H11F3N2O2 |
| Molecular Weight | 248.20 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | N-(1-aminopropan-2-yl)-2,4,5-trifluoro-3-hydroxybenzamide |
| SMILES | CC(CN)NC(=O)c1cc(F)c(F)c(O)c1F |
| InChI | InChI=1S/C10H11F3N2O2/c1-4(3-14)15-10(17)5-2-6(11)8(13)9(16)7(5)12/h2,4,16H,3,14H2,1H3,(H,15,17) |
| InChIKey | VMGGACCMICQXHM-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.20 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|