C13H14F3NO4 — CID 103926890
(2R)-3,3-dimethyl-2-[(2,4,5-trifluoro-3-hydroxybenzoyl)amino]butanoic acid (PubChem CID 103926890) has the molecular formula C13H14F3NO4 and a molecular weight of 305.25 g/mol. Its IUPAC name is (2R)-3,3-dimethyl-2-[(2,4,5-trifluoro-3-hydroxybenzoyl)amino]butanoic acid.
| Compound Name | (2R)-3,3-dimethyl-2-[(2,4,5-trifluoro-3-hydroxybenzoyl)amino]butanoic acid |
|---|---|
| PubChem CID | 103926890 |
| Molecular Formula | C13H14F3NO4 |
| Molecular Weight | 305.25 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | (2R)-3,3-dimethyl-2-[(2,4,5-trifluoro-3-hydroxybenzoyl)amino]butanoic acid |
| SMILES | CC(C)(C)[C@@H](NC(=O)c1cc(F)c(F)c(O)c1F)C(=O)O |
| InChI | InChI=1S/C13H14F3NO4/c1-13(2,3)10(12(20)21)17-11(19)5-4-6(14)8(16)9(18)7(5)15/h4,10,18H,1-3H3,(H,17,19)(H,20,21)/t10-/m0/s1 |
| InChIKey | YCJLBWDKUWVTPM-JTQLQIEISA-N |
| XLogP | 2.04 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.25 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|