C13H17FN2O3 — CID 103927182
(2R)-2-[(2-amino-5-fluorobenzoyl)amino]-3,3-dimethylbutanoic acid (PubChem CID 103927182) has the molecular formula C13H17FN2O3 and a molecular weight of 268.29 g/mol. Its IUPAC name is (2R)-2-[(2-amino-5-fluorobenzoyl)amino]-3,3-dimethylbutanoic acid.
| Compound Name | (2R)-2-[(2-amino-5-fluorobenzoyl)amino]-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 103927182 |
| Molecular Formula | C13H17FN2O3 |
| Molecular Weight | 268.29 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | (2R)-2-[(2-amino-5-fluorobenzoyl)amino]-3,3-dimethylbutanoic acid |
| SMILES | CC(C)(C)[C@@H](NC(=O)c1cc(F)ccc1N)C(=O)O |
| InChI | InChI=1S/C13H17FN2O3/c1-13(2,3)10(12(18)19)16-11(17)8-6-7(14)4-5-9(8)15/h4-6,10H,15H2,1-3H3,(H,16,17)(H,18,19)/t10-/m0/s1 |
| InChIKey | CXRXRIZDKAJQOW-JTQLQIEISA-N |
| XLogP | 1.64 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.29 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|