C14H20N2O3 — CID 103927250
(2R)-2-[(3-amino-2-methylbenzoyl)amino]-3,3-dimethylbutanoic acid (PubChem CID 103927250) has the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. Its IUPAC name is (2R)-2-[(3-amino-2-methylbenzoyl)amino]-3,3-dimethylbutanoic acid.
| Compound Name | (2R)-2-[(3-amino-2-methylbenzoyl)amino]-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 103927250 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | (2R)-2-[(3-amino-2-methylbenzoyl)amino]-3,3-dimethylbutanoic acid |
| SMILES | Cc1c(N)cccc1C(=O)N[C@@H](C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C14H20N2O3/c1-8-9(6-5-7-10(8)15)12(17)16-11(13(18)19)14(2,3)4/h5-7,11H,15H2,1-4H3,(H,16,17)(H,18,19)/t11-/m0/s1 |
| InChIKey | RNGAFVIAHAFJPI-NSHDSACASA-N |
| XLogP | 1.81 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|