C13H16INO3 — CID 113353045
(2R)-2-[(2-iodobenzoyl)amino]-3,3-dimethylbutanoic acid (PubChem CID 113353045) has the molecular formula C13H16INO3 and a molecular weight of 361.18 g/mol. Its IUPAC name is (2R)-2-[(2-iodobenzoyl)amino]-3,3-dimethylbutanoic acid.
| Compound Name | (2R)-2-[(2-iodobenzoyl)amino]-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 113353045 |
| Molecular Formula | C13H16INO3 |
| Molecular Weight | 361.18 g/mol |
| Exact Mass | 361.02 |
| IUPAC Name | (2R)-2-[(2-iodobenzoyl)amino]-3,3-dimethylbutanoic acid |
| SMILES | CC(C)(C)[C@@H](NC(=O)c1ccccc1I)C(=O)O |
| InChI | InChI=1S/C13H16INO3/c1-13(2,3)10(12(17)18)15-11(16)8-6-4-5-7-9(8)14/h4-7,10H,1-3H3,(H,15,16)(H,17,18)/t10-/m0/s1 |
| InChIKey | NUXMYHDXZBMVPG-JTQLQIEISA-N |
| XLogP | 2.52 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.18 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|