C10H10INO3S — CID 16775410
2-[(2-iodobenzoyl)amino]-3-sulfanylpropanoic acid (PubChem CID 16775410) has the molecular formula C10H10INO3S and a molecular weight of 351.17 g/mol. Its IUPAC name is 2-[(2-iodobenzoyl)amino]-3-sulfanylpropanoic acid.
| Compound Name | 2-[(2-iodobenzoyl)amino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 16775410 |
| Molecular Formula | C10H10INO3S |
| Molecular Weight | 351.17 g/mol |
| Exact Mass | 350.94 |
| IUPAC Name | 2-[(2-iodobenzoyl)amino]-3-sulfanylpropanoic acid |
| SMILES | O=C(NC(CS)C(=O)O)c1ccccc1I |
| InChI | InChI=1S/C10H10INO3S/c11-7-4-2-1-3-6(7)9(13)12-8(5-16)10(14)15/h1-4,8,16H,5H2,(H,12,13)(H,14,15) |
| InChIKey | PAZBLRRWODRUJM-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.17 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|