C8H9NO3S2 — CID 54554377
(2R)-3-sulfanyl-2-(thiophene-2-carbonylamino)propanoic acid (PubChem CID 54554377) has the molecular formula C8H9NO3S2 and a molecular weight of 231.30 g/mol. Its IUPAC name is (2R)-3-sulfanyl-2-(thiophene-2-carbonylamino)propanoic acid.
| Compound Name | (2R)-3-sulfanyl-2-(thiophene-2-carbonylamino)propanoic acid |
|---|---|
| PubChem CID | 54554377 |
| Molecular Formula | C8H9NO3S2 |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.00 |
| IUPAC Name | (2R)-3-sulfanyl-2-(thiophene-2-carbonylamino)propanoic acid |
| SMILES | O=C(N[C@@H](CS)C(=O)O)c1cccs1 |
| InChI | InChI=1S/C8H9NO3S2/c10-7(6-2-1-3-14-6)9-5(4-13)8(11)12/h1-3,5,13H,4H2,(H,9,10)(H,11,12)/t5-/m0/s1 |
| InChIKey | ZMDATQAKXMSXGA-YFKPBYRVSA-N |
| XLogP | 0.86 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|