C8H8NO3S2- — CID 3703384
3-sulfanyl-2-(thiophene-2-carbonylamino)propanoate (PubChem CID 3703384) has the molecular formula C8H8NO3S2- and a molecular weight of 230.29 g/mol. Its IUPAC name is 3-sulfanyl-2-(thiophene-2-carbonylamino)propanoate.
| Compound Name | 3-sulfanyl-2-(thiophene-2-carbonylamino)propanoate |
|---|---|
| PubChem CID | 3703384 |
| Molecular Formula | C8H8NO3S2- |
| Molecular Weight | 230.29 g/mol |
| Exact Mass | 230.00 |
| IUPAC Name | 3-sulfanyl-2-(thiophene-2-carbonylamino)propanoate |
| SMILES | O=C(NC(CS)C(=O)[O-])c1cccs1 |
| InChI | InChI=1S/C8H9NO3S2/c10-7(6-2-1-3-14-6)9-5(4-13)8(11)12/h1-3,5,13H,4H2,(H,9,10)(H,11,12)/p-1 |
| InChIKey | ZMDATQAKXMSXGA-UHFFFAOYSA-M |
| XLogP | -0.47 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.29 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|