C11H13NO4S2 — CID 108796380
2-[(4-oxo-4-thiophen-2-ylbutanoyl)amino]-3-sulfanylpropanoic acid (PubChem CID 108796380) has the molecular formula C11H13NO4S2 and a molecular weight of 287.36 g/mol. Its IUPAC name is 2-[(4-oxo-4-thiophen-2-ylbutanoyl)amino]-3-sulfanylpropanoic acid.
| Compound Name | 2-[(4-oxo-4-thiophen-2-ylbutanoyl)amino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 108796380 |
| Molecular Formula | C11H13NO4S2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.03 |
| IUPAC Name | 2-[(4-oxo-4-thiophen-2-ylbutanoyl)amino]-3-sulfanylpropanoic acid |
| SMILES | O=C(CCC(=O)c1cccs1)NC(CS)C(=O)O |
| InChI | InChI=1S/C11H13NO4S2/c13-8(9-2-1-5-18-9)3-4-10(14)12-7(6-17)11(15)16/h1-2,5,7,17H,3-4,6H2,(H,12,14)(H,15,16) |
| InChIKey | AQNJBYAVWAQVJG-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|