C16H16BrNO2S — CID 9218839
N-[(1S)-1-(4-bromophenyl)ethyl]-4-oxo-4-thiophen-2-ylbutanamide (PubChem CID 9218839) has the molecular formula C16H16BrNO2S and a molecular weight of 366.28 g/mol. Its IUPAC name is N-[(1S)-1-(4-bromophenyl)ethyl]-4-oxo-4-thiophen-2-ylbutanamide.
| Compound Name | N-[(1S)-1-(4-bromophenyl)ethyl]-4-oxo-4-thiophen-2-ylbutanamide |
|---|---|
| PubChem CID | 9218839 |
| Molecular Formula | C16H16BrNO2S |
| Molecular Weight | 366.28 g/mol |
| Exact Mass | 365.01 |
| IUPAC Name | N-[(1S)-1-(4-bromophenyl)ethyl]-4-oxo-4-thiophen-2-ylbutanamide |
| SMILES | C[C@H](NC(=O)CCC(=O)c1cccs1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C16H16BrNO2S/c1-11(12-4-6-13(17)7-5-12)18-16(20)9-8-14(19)15-3-2-10-21-15/h2-7,10-11H,8-9H2,1H3,(H,18,20)/t11-/m0/s1 |
| InChIKey | FPKWLSQACQRWDP-NSHDSACASA-N |
| XLogP | 4.35 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.28 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |