C19H20ClNO3S — CID 42956084
N-[1-(4-chlorophenyl)ethyl]-4,7-dioxo-7-thiophen-2-ylheptanamide (PubChem CID 42956084) has the molecular formula C19H20ClNO3S and a molecular weight of 377.89 g/mol. Its IUPAC name is N-[1-(4-chlorophenyl)ethyl]-4,7-dioxo-7-thiophen-2-ylheptanamide.
| Compound Name | N-[1-(4-chlorophenyl)ethyl]-4,7-dioxo-7-thiophen-2-ylheptanamide |
|---|---|
| PubChem CID | 42956084 |
| Molecular Formula | C19H20ClNO3S |
| Molecular Weight | 377.89 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | N-[1-(4-chlorophenyl)ethyl]-4,7-dioxo-7-thiophen-2-ylheptanamide |
| SMILES | CC(NC(=O)CCC(=O)CCC(=O)c1cccs1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H20ClNO3S/c1-13(14-4-6-15(20)7-5-14)21-19(24)11-9-16(22)8-10-17(23)18-3-2-12-25-18/h2-7,12-13H,8-11H2,1H3,(H,21,24) |
| InChIKey | UAGIKDGRBFACCQ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.89 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |