C12H13ClNNaO3 — CID 154832871
sodium 4-[1-(4-chlorophenyl)ethylamino]-4-oxobutanoate (PubChem CID 154832871) has the molecular formula C12H13ClNNaO3 and a molecular weight of 277.68 g/mol. Its IUPAC name is sodium 4-[1-(4-chlorophenyl)ethylamino]-4-oxobutanoate.
| Compound Name | sodium 4-[1-(4-chlorophenyl)ethylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 154832871 |
| Molecular Formula | C12H13ClNNaO3 |
| Molecular Weight | 277.68 g/mol |
| Exact Mass | 277.05 |
| IUPAC Name | sodium 4-[1-(4-chlorophenyl)ethylamino]-4-oxobutanoate |
| SMILES | CC(NC(=O)CCC(=O)[O-])c1ccc(Cl)cc1.[Na+] |
| InChI | InChI=1S/C12H14ClNO3.Na/c1-8(9-2-4-10(13)5-3-9)14-11(15)6-7-12(16)17;/h2-5,8H,6-7H2,1H3,(H,14,15)(H,16,17);/q;+1/p-1 |
| InChIKey | LSLVBMFBPMFJKO-UHFFFAOYSA-M |
| XLogP | -1.95 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.68 |
| LogP ≤ 5 | -1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |