C14H18ClNO3 — CID 81356588
ethyl 4-[[(1S)-1-(4-chlorophenyl)ethyl]amino]-4-oxobutanoate (PubChem CID 81356588) has the molecular formula C14H18ClNO3 and a molecular weight of 283.76 g/mol. Its IUPAC name is ethyl 4-[[(1S)-1-(4-chlorophenyl)ethyl]amino]-4-oxobutanoate.
| Compound Name | ethyl 4-[[(1S)-1-(4-chlorophenyl)ethyl]amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 81356588 |
| Molecular Formula | C14H18ClNO3 |
| Molecular Weight | 283.76 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | ethyl 4-[[(1S)-1-(4-chlorophenyl)ethyl]amino]-4-oxobutanoate |
| SMILES | CCOC(=O)CCC(=O)N[C@@H](C)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H18ClNO3/c1-3-19-14(18)9-8-13(17)16-10(2)11-4-6-12(15)7-5-11/h4-7,10H,3,8-9H2,1-2H3,(H,16,17)/t10-/m0/s1 |
| InChIKey | CMUJEISVLMJNMK-JTQLQIEISA-N |
| XLogP | 2.86 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.76 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |