C22H24ClNO4 — CID 8579596
[2-[[(1R)-1-(4-ethylphenyl)ethyl]amino]-2-oxoethyl] 4-(4-chlorophenyl)-4-oxobutanoate (PubChem CID 8579596) has the molecular formula C22H24ClNO4 and a molecular weight of 401.89 g/mol. Its IUPAC name is [2-[[(1R)-1-(4-ethylphenyl)ethyl]amino]-2-oxoethyl] 4-(4-chlorophenyl)-4-oxobutanoate.
| Compound Name | [2-[[(1R)-1-(4-ethylphenyl)ethyl]amino]-2-oxoethyl] 4-(4-chlorophenyl)-4-oxobutanoate |
|---|---|
| PubChem CID | 8579596 |
| Molecular Formula | C22H24ClNO4 |
| Molecular Weight | 401.89 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | [2-[[(1R)-1-(4-ethylphenyl)ethyl]amino]-2-oxoethyl] 4-(4-chlorophenyl)-4-oxobutanoate |
| SMILES | CCc1ccc([C@@H](C)NC(=O)COC(=O)CCC(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C22H24ClNO4/c1-3-16-4-6-17(7-5-16)15(2)24-21(26)14-28-22(27)13-12-20(25)18-8-10-19(23)11-9-18/h4-11,15H,3,12-14H2,1-2H3,(H,24,26)/t15-/m1/s1 |
| InChIKey | LDPJNOMYNKXSNS-OAHLLOKOSA-N |
| XLogP | 4.29 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.89 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |