C20H19Cl2NO4 — CID 8579787
[2-[[(1S)-1-(2-chlorophenyl)ethyl]amino]-2-oxoethyl] 4-(4-chlorophenyl)-4-oxobutanoate (PubChem CID 8579787) has the molecular formula C20H19Cl2NO4 and a molecular weight of 408.28 g/mol. Its IUPAC name is [2-[[(1S)-1-(2-chlorophenyl)ethyl]amino]-2-oxoethyl] 4-(4-chlorophenyl)-4-oxobutanoate.
| Compound Name | [2-[[(1S)-1-(2-chlorophenyl)ethyl]amino]-2-oxoethyl] 4-(4-chlorophenyl)-4-oxobutanoate |
|---|---|
| PubChem CID | 8579787 |
| Molecular Formula | C20H19Cl2NO4 |
| Molecular Weight | 408.28 g/mol |
| Exact Mass | 407.07 |
| IUPAC Name | [2-[[(1S)-1-(2-chlorophenyl)ethyl]amino]-2-oxoethyl] 4-(4-chlorophenyl)-4-oxobutanoate |
| SMILES | C[C@H](NC(=O)COC(=O)CCC(=O)c1ccc(Cl)cc1)c1ccccc1Cl |
| InChI | InChI=1S/C20H19Cl2NO4/c1-13(16-4-2-3-5-17(16)22)23-19(25)12-27-20(26)11-10-18(24)14-6-8-15(21)9-7-14/h2-9,13H,10-12H2,1H3,(H,23,25)/t13-/m0/s1 |
| InChIKey | HKUVOIAIYWLGIR-ZDUSSCGKSA-N |
| XLogP | 4.38 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.28 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |