C23H20ClNO4S — CID 46829010
[2-oxo-2-[[phenyl(thiophen-2-yl)methyl]amino]ethyl] 4-(4-chlorophenyl)-4-oxobutanoate (PubChem CID 46829010) has the molecular formula C23H20ClNO4S and a molecular weight of 441.94 g/mol. Its IUPAC name is [2-oxo-2-[[phenyl(thiophen-2-yl)methyl]amino]ethyl] 4-(4-chlorophenyl)-4-oxobutanoate.
| Compound Name | [2-oxo-2-[[phenyl(thiophen-2-yl)methyl]amino]ethyl] 4-(4-chlorophenyl)-4-oxobutanoate |
|---|---|
| PubChem CID | 46829010 |
| Molecular Formula | C23H20ClNO4S |
| Molecular Weight | 441.94 g/mol |
| Exact Mass | 441.08 |
| IUPAC Name | [2-oxo-2-[[phenyl(thiophen-2-yl)methyl]amino]ethyl] 4-(4-chlorophenyl)-4-oxobutanoate |
| SMILES | O=C(COC(=O)CCC(=O)c1ccc(Cl)cc1)NC(c1ccccc1)c1cccs1 |
| InChI | InChI=1S/C23H20ClNO4S/c24-18-10-8-16(9-11-18)19(26)12-13-22(28)29-15-21(27)25-23(20-7-4-14-30-20)17-5-2-1-3-6-17/h1-11,14,23H,12-13,15H2,(H,25,27) |
| InChIKey | RUHXDIOHGKWOPG-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.94 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |