C20H16ClNO4S — CID 9342569
[2-oxo-2-[[(R)-phenyl(thiophen-2-yl)methyl]amino]ethyl] 4-chloro-2-hydroxybenzoate (PubChem CID 9342569) has the molecular formula C20H16ClNO4S and a molecular weight of 401.87 g/mol. Its IUPAC name is [2-oxo-2-[[(R)-phenyl(thiophen-2-yl)methyl]amino]ethyl] 4-chloro-2-hydroxybenzoate.
| Compound Name | [2-oxo-2-[[(R)-phenyl(thiophen-2-yl)methyl]amino]ethyl] 4-chloro-2-hydroxybenzoate |
|---|---|
| PubChem CID | 9342569 |
| Molecular Formula | C20H16ClNO4S |
| Molecular Weight | 401.87 g/mol |
| Exact Mass | 401.05 |
| IUPAC Name | [2-oxo-2-[[(R)-phenyl(thiophen-2-yl)methyl]amino]ethyl] 4-chloro-2-hydroxybenzoate |
| SMILES | O=C(COC(=O)c1ccc(Cl)cc1O)N[C@H](c1ccccc1)c1cccs1 |
| InChI | InChI=1S/C20H16ClNO4S/c21-14-8-9-15(16(23)11-14)20(25)26-12-18(24)22-19(17-7-4-10-27-17)13-5-2-1-3-6-13/h1-11,19,23H,12H2,(H,22,24)/t19-/m1/s1 |
| InChIKey | HFWJEYJMONHSLZ-LJQANCHMSA-N |
| XLogP | 4.17 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.87 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |