C22H17ClFNO3 — CID 8619818
[2-(benzhydrylamino)-2-oxoethyl] 5-chloro-2-fluorobenzoate (PubChem CID 8619818) has the molecular formula C22H17ClFNO3 and a molecular weight of 397.83 g/mol. Its IUPAC name is [2-(benzhydrylamino)-2-oxoethyl] 5-chloro-2-fluorobenzoate.
| Compound Name | [2-(benzhydrylamino)-2-oxoethyl] 5-chloro-2-fluorobenzoate |
|---|---|
| PubChem CID | 8619818 |
| Molecular Formula | C22H17ClFNO3 |
| Molecular Weight | 397.83 g/mol |
| Exact Mass | 397.09 |
| IUPAC Name | [2-(benzhydrylamino)-2-oxoethyl] 5-chloro-2-fluorobenzoate |
| SMILES | O=C(COC(=O)c1cc(Cl)ccc1F)NC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H17ClFNO3/c23-17-11-12-19(24)18(13-17)22(27)28-14-20(26)25-21(15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-13,21H,14H2,(H,25,26) |
| InChIKey | QVPBKOCGGUCDBR-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.83 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |