C23H20ClNO4S — CID 17467396
[2-[[(4-chlorophenyl)-phenylmethyl]amino]-2-oxoethyl] 2-methylsulfinylbenzoate (PubChem CID 17467396) has the molecular formula C23H20ClNO4S and a molecular weight of 441.94 g/mol. Its IUPAC name is [2-[[(4-chlorophenyl)-phenylmethyl]amino]-2-oxoethyl] 2-methylsulfinylbenzoate.
| Compound Name | [2-[[(4-chlorophenyl)-phenylmethyl]amino]-2-oxoethyl] 2-methylsulfinylbenzoate |
|---|---|
| PubChem CID | 17467396 |
| Molecular Formula | C23H20ClNO4S |
| Molecular Weight | 441.94 g/mol |
| Exact Mass | 441.08 |
| IUPAC Name | [2-[[(4-chlorophenyl)-phenylmethyl]amino]-2-oxoethyl] 2-methylsulfinylbenzoate |
| SMILES | CS(=O)c1ccccc1C(=O)OCC(=O)NC(c1ccccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H20ClNO4S/c1-30(28)20-10-6-5-9-19(20)23(27)29-15-21(26)25-22(16-7-3-2-4-8-16)17-11-13-18(24)14-12-17/h2-14,22H,15H2,1H3,(H,25,26) |
| InChIKey | HIGJGUKHULRLEZ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.94 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |