C20H23NO4S — CID 11927590
[2-oxo-2-[[(1S)-1-phenylbutyl]amino]ethyl] 2-[(S)-methylsulfinyl]benzoate (PubChem CID 11927590) has the molecular formula C20H23NO4S and a molecular weight of 373.47 g/mol. Its IUPAC name is [2-oxo-2-[[(1S)-1-phenylbutyl]amino]ethyl] 2-[(S)-methylsulfinyl]benzoate.
| Compound Name | [2-oxo-2-[[(1S)-1-phenylbutyl]amino]ethyl] 2-[(S)-methylsulfinyl]benzoate |
|---|---|
| PubChem CID | 11927590 |
| Molecular Formula | C20H23NO4S |
| Molecular Weight | 373.47 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | [2-oxo-2-[[(1S)-1-phenylbutyl]amino]ethyl] 2-[(S)-methylsulfinyl]benzoate |
| SMILES | CCC[C@H](NC(=O)COC(=O)c1ccccc1[S@](C)=O)c1ccccc1 |
| InChI | InChI=1S/C20H23NO4S/c1-3-9-17(15-10-5-4-6-11-15)21-19(22)14-25-20(23)16-12-7-8-13-18(16)26(2)24/h4-8,10-13,17H,3,9,14H2,1-2H3,(H,21,22)/t17-,26-/m0/s1 |
| InChIKey | FLVBIBJNEKUDLK-QLXKLKPCSA-N |
| XLogP | 3.24 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.47 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |