C17H16ClNO4S — CID 11926927
[2-(4-chloro-2-methylanilino)-2-oxoethyl] 2-[(S)-methylsulfinyl]benzoate (PubChem CID 11926927) has the molecular formula C17H16ClNO4S and a molecular weight of 365.84 g/mol. Its IUPAC name is [2-(4-chloro-2-methylanilino)-2-oxoethyl] 2-[(S)-methylsulfinyl]benzoate.
| Compound Name | [2-(4-chloro-2-methylanilino)-2-oxoethyl] 2-[(S)-methylsulfinyl]benzoate |
|---|---|
| PubChem CID | 11926927 |
| Molecular Formula | C17H16ClNO4S |
| Molecular Weight | 365.84 g/mol |
| Exact Mass | 365.05 |
| IUPAC Name | [2-(4-chloro-2-methylanilino)-2-oxoethyl] 2-[(S)-methylsulfinyl]benzoate |
| SMILES | Cc1cc(Cl)ccc1NC(=O)COC(=O)c1ccccc1[S@](C)=O |
| InChI | InChI=1S/C17H16ClNO4S/c1-11-9-12(18)7-8-14(11)19-16(20)10-23-17(21)13-5-3-4-6-15(13)24(2)22/h3-9H,10H2,1-2H3,(H,19,20)/t24-/m0/s1 |
| InChIKey | IRRFUSLJKYPKNH-DEOSSOPVSA-N |
| XLogP | 3.18 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.84 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |