C20H16ClNO4 — CID 7891384
[2-(4-chloro-2-methylanilino)-2-oxoethyl] 3-hydroxynaphthalene-2-carboxylate (PubChem CID 7891384) has the molecular formula C20H16ClNO4 and a molecular weight of 369.80 g/mol. Its IUPAC name is [2-(4-chloro-2-methylanilino)-2-oxoethyl] 3-hydroxynaphthalene-2-carboxylate.
| Compound Name | [2-(4-chloro-2-methylanilino)-2-oxoethyl] 3-hydroxynaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 7891384 |
| Molecular Formula | C20H16ClNO4 |
| Molecular Weight | 369.80 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | [2-(4-chloro-2-methylanilino)-2-oxoethyl] 3-hydroxynaphthalene-2-carboxylate |
| SMILES | Cc1cc(Cl)ccc1NC(=O)COC(=O)c1cc2ccccc2cc1O |
| InChI | InChI=1S/C20H16ClNO4/c1-12-8-15(21)6-7-17(12)22-19(24)11-26-20(25)16-9-13-4-2-3-5-14(13)10-18(16)23/h2-10,23H,11H2,1H3,(H,22,24) |
| InChIKey | VGNNOJCTCMVPHZ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.80 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |