C19H20N2O6S — CID 11927664
[2-(5-acetamido-2-methoxyanilino)-2-oxoethyl] 2-[(S)-methylsulfinyl]benzoate (PubChem CID 11927664) has the molecular formula C19H20N2O6S and a molecular weight of 404.44 g/mol. Its IUPAC name is [2-(5-acetamido-2-methoxyanilino)-2-oxoethyl] 2-[(S)-methylsulfinyl]benzoate.
| Compound Name | [2-(5-acetamido-2-methoxyanilino)-2-oxoethyl] 2-[(S)-methylsulfinyl]benzoate |
|---|---|
| PubChem CID | 11927664 |
| Molecular Formula | C19H20N2O6S |
| Molecular Weight | 404.44 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | [2-(5-acetamido-2-methoxyanilino)-2-oxoethyl] 2-[(S)-methylsulfinyl]benzoate |
| SMILES | COc1ccc(NC(C)=O)cc1NC(=O)COC(=O)c1ccccc1[S@](C)=O |
| InChI | InChI=1S/C19H20N2O6S/c1-12(22)20-13-8-9-16(26-2)15(10-13)21-18(23)11-27-19(24)14-6-4-5-7-17(14)28(3)25/h4-10H,11H2,1-3H3,(H,20,22)(H,21,23)/t28-/m0/s1 |
| InChIKey | KEAIELMNIAJYOF-NDEPHWFRSA-N |
| XLogP | 2.19 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.44 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |