C16H13ClINO3 — CID 71823697
[2-(5-chloro-2-methylanilino)-2-oxoethyl] 2-iodobenzoate (PubChem CID 71823697) has the molecular formula C16H13ClINO3 and a molecular weight of 429.64 g/mol. Its IUPAC name is [2-(5-chloro-2-methylanilino)-2-oxoethyl] 2-iodobenzoate.
| Compound Name | [2-(5-chloro-2-methylanilino)-2-oxoethyl] 2-iodobenzoate |
|---|---|
| PubChem CID | 71823697 |
| Molecular Formula | C16H13ClINO3 |
| Molecular Weight | 429.64 g/mol |
| Exact Mass | 428.96 |
| IUPAC Name | [2-(5-chloro-2-methylanilino)-2-oxoethyl] 2-iodobenzoate |
| SMILES | Cc1ccc(Cl)cc1NC(=O)COC(=O)c1ccccc1I |
| InChI | InChI=1S/C16H13ClINO3/c1-10-6-7-11(17)8-14(10)19-15(20)9-22-16(21)12-4-2-3-5-13(12)18/h2-8H,9H2,1H3,(H,19,20) |
| InChIKey | USSAXHJFIGZFSY-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.64 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|