C16H14ClNO4S — CID 18123082
[2-(5-chloro-2-methylanilino)-2-oxoethyl] 5-acetylthiophene-2-carboxylate (PubChem CID 18123082) has the molecular formula C16H14ClNO4S and a molecular weight of 351.81 g/mol. Its IUPAC name is [2-(5-chloro-2-methylanilino)-2-oxoethyl] 5-acetylthiophene-2-carboxylate.
| Compound Name | [2-(5-chloro-2-methylanilino)-2-oxoethyl] 5-acetylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 18123082 |
| Molecular Formula | C16H14ClNO4S |
| Molecular Weight | 351.81 g/mol |
| Exact Mass | 351.03 |
| IUPAC Name | [2-(5-chloro-2-methylanilino)-2-oxoethyl] 5-acetylthiophene-2-carboxylate |
| SMILES | CC(=O)c1ccc(C(=O)OCC(=O)Nc2cc(Cl)ccc2C)s1 |
| InChI | InChI=1S/C16H14ClNO4S/c1-9-3-4-11(17)7-12(9)18-15(20)8-22-16(21)14-6-5-13(23-14)10(2)19/h3-7H,8H2,1-2H3,(H,18,20) |
| InChIKey | GFTOUDBUHOGVDU-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.81 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |