C21H18FNO4S — CID 8540773
[2-oxo-2-[[(R)-phenyl(thiophen-2-yl)methyl]amino]ethyl] 3-fluoro-4-methoxybenzoate (PubChem CID 8540773) has the molecular formula C21H18FNO4S and a molecular weight of 399.44 g/mol. Its IUPAC name is [2-oxo-2-[[(R)-phenyl(thiophen-2-yl)methyl]amino]ethyl] 3-fluoro-4-methoxybenzoate.
| Compound Name | [2-oxo-2-[[(R)-phenyl(thiophen-2-yl)methyl]amino]ethyl] 3-fluoro-4-methoxybenzoate |
|---|---|
| PubChem CID | 8540773 |
| Molecular Formula | C21H18FNO4S |
| Molecular Weight | 399.44 g/mol |
| Exact Mass | 399.09 |
| IUPAC Name | [2-oxo-2-[[(R)-phenyl(thiophen-2-yl)methyl]amino]ethyl] 3-fluoro-4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)OCC(=O)N[C@H](c2ccccc2)c2cccs2)cc1F |
| InChI | InChI=1S/C21H18FNO4S/c1-26-17-10-9-15(12-16(17)22)21(25)27-13-19(24)23-20(18-8-5-11-28-18)14-6-3-2-4-7-14/h2-12,20H,13H2,1H3,(H,23,24)/t20-/m1/s1 |
| InChIKey | WMSBXHYJMFWOKP-HXUWFJFHSA-N |
| XLogP | 3.96 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.44 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |