C21H18FNO5S — CID 43032778
[2-[[(4-fluorophenyl)-thiophen-2-ylmethyl]amino]-2-oxoethyl] 2-hydroxy-3-methoxybenzoate (PubChem CID 43032778) has the molecular formula C21H18FNO5S and a molecular weight of 415.44 g/mol. Its IUPAC name is [2-[[(4-fluorophenyl)-thiophen-2-ylmethyl]amino]-2-oxoethyl] 2-hydroxy-3-methoxybenzoate.
| Compound Name | [2-[[(4-fluorophenyl)-thiophen-2-ylmethyl]amino]-2-oxoethyl] 2-hydroxy-3-methoxybenzoate |
|---|---|
| PubChem CID | 43032778 |
| Molecular Formula | C21H18FNO5S |
| Molecular Weight | 415.44 g/mol |
| Exact Mass | 415.09 |
| IUPAC Name | [2-[[(4-fluorophenyl)-thiophen-2-ylmethyl]amino]-2-oxoethyl] 2-hydroxy-3-methoxybenzoate |
| SMILES | COc1cccc(C(=O)OCC(=O)NC(c2ccc(F)cc2)c2cccs2)c1O |
| InChI | InChI=1S/C21H18FNO5S/c1-27-16-5-2-4-15(20(16)25)21(26)28-12-18(24)23-19(17-6-3-11-29-17)13-7-9-14(22)10-8-13/h2-11,19,25H,12H2,1H3,(H,23,24) |
| InChIKey | KJPNKFYIUGGBNY-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.44 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |