C22H20FNO4S — CID 8808304
2-(4-acetyl-2-methoxyphenoxy)-N-[(S)-(4-fluorophenyl)-thiophen-2-ylmethyl]acetamide (PubChem CID 8808304) has the molecular formula C22H20FNO4S and a molecular weight of 413.47 g/mol. Its IUPAC name is 2-(4-acetyl-2-methoxyphenoxy)-N-[(S)-(4-fluorophenyl)-thiophen-2-ylmethyl]acetamide.
| Compound Name | 2-(4-acetyl-2-methoxyphenoxy)-N-[(S)-(4-fluorophenyl)-thiophen-2-ylmethyl]acetamide |
|---|---|
| PubChem CID | 8808304 |
| Molecular Formula | C22H20FNO4S |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | 2-(4-acetyl-2-methoxyphenoxy)-N-[(S)-(4-fluorophenyl)-thiophen-2-ylmethyl]acetamide |
| SMILES | COc1cc(C(C)=O)ccc1OCC(=O)N[C@@H](c1ccc(F)cc1)c1cccs1 |
| InChI | InChI=1S/C22H20FNO4S/c1-14(25)16-7-10-18(19(12-16)27-2)28-13-21(26)24-22(20-4-3-11-29-20)15-5-8-17(23)9-6-15/h3-12,22H,13H2,1-2H3,(H,24,26)/t22-/m0/s1 |
| InChIKey | DFLIZZVHQOXFMF-QFIPXVFZSA-N |
| XLogP | 4.38 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |