C20H17FN2O5S — CID 8566593
N-[(S)-(4-fluorophenyl)-thiophen-2-ylmethyl]-2-(2-methoxy-5-nitrophenoxy)acetamide (PubChem CID 8566593) has the molecular formula C20H17FN2O5S and a molecular weight of 416.43 g/mol. Its IUPAC name is N-[(S)-(4-fluorophenyl)-thiophen-2-ylmethyl]-2-(2-methoxy-5-nitrophenoxy)acetamide.
| Compound Name | N-[(S)-(4-fluorophenyl)-thiophen-2-ylmethyl]-2-(2-methoxy-5-nitrophenoxy)acetamide |
|---|---|
| PubChem CID | 8566593 |
| Molecular Formula | C20H17FN2O5S |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 416.08 |
| IUPAC Name | N-[(S)-(4-fluorophenyl)-thiophen-2-ylmethyl]-2-(2-methoxy-5-nitrophenoxy)acetamide |
| SMILES | COc1ccc([N+](=O)[O-])cc1OCC(=O)N[C@@H](c1ccc(F)cc1)c1cccs1 |
| InChI | InChI=1S/C20H17FN2O5S/c1-27-16-9-8-15(23(25)26)11-17(16)28-12-19(24)22-20(18-3-2-10-29-18)13-4-6-14(21)7-5-13/h2-11,20H,12H2,1H3,(H,22,24)/t20-/m0/s1 |
| InChIKey | QIABRBVBJWUMBH-FQEVSTJZSA-N |
| XLogP | 4.09 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|