C21H16FN5O3S — CID 52516691
N-[(R)-(4-fluorophenyl)-thiophen-2-ylmethyl]-2-[3-(3-nitrophenyl)-1,2,4-triazol-1-yl]acetamide (PubChem CID 52516691) has the molecular formula C21H16FN5O3S and a molecular weight of 437.46 g/mol. Its IUPAC name is N-[(R)-(4-fluorophenyl)-thiophen-2-ylmethyl]-2-[3-(3-nitrophenyl)-1,2,4-triazol-1-yl]acetamide.
| Compound Name | N-[(R)-(4-fluorophenyl)-thiophen-2-ylmethyl]-2-[3-(3-nitrophenyl)-1,2,4-triazol-1-yl]acetamide |
|---|---|
| PubChem CID | 52516691 |
| Molecular Formula | C21H16FN5O3S |
| Molecular Weight | 437.46 g/mol |
| Exact Mass | 437.10 |
| IUPAC Name | N-[(R)-(4-fluorophenyl)-thiophen-2-ylmethyl]-2-[3-(3-nitrophenyl)-1,2,4-triazol-1-yl]acetamide |
| SMILES | O=C(Cn1cnc(-c2cccc([N+](=O)[O-])c2)n1)N[C@H](c1ccc(F)cc1)c1cccs1 |
| InChI | InChI=1S/C21H16FN5O3S/c22-16-8-6-14(7-9-16)20(18-5-2-10-31-18)24-19(28)12-26-13-23-21(25-26)15-3-1-4-17(11-15)27(29)30/h1-11,13,20H,12H2,(H,24,28)/t20-/m1/s1 |
| InChIKey | NFJDVUOUCNDOGZ-HXUWFJFHSA-N |
| XLogP | 3.96 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.46 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|