C10H10N4O3 — CID 115622124
2-[3-(3-nitrophenyl)-1,2,4-triazol-1-yl]ethanol (PubChem CID 115622124) has the molecular formula C10H10N4O3 and a molecular weight of 234.22 g/mol. Its IUPAC name is 2-[3-(3-nitrophenyl)-1,2,4-triazol-1-yl]ethanol.
| Compound Name | 2-[3-(3-nitrophenyl)-1,2,4-triazol-1-yl]ethanol |
|---|---|
| PubChem CID | 115622124 |
| Molecular Formula | C10H10N4O3 |
| Molecular Weight | 234.22 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | 2-[3-(3-nitrophenyl)-1,2,4-triazol-1-yl]ethanol |
| SMILES | O=[N+]([O-])c1cccc(-c2ncn(CCO)n2)c1 |
| InChI | InChI=1S/C10H10N4O3/c15-5-4-13-7-11-10(12-13)8-2-1-3-9(6-8)14(16)17/h1-3,6-7,15H,4-5H2 |
| InChIKey | HYFKJWPQLNKABY-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 94.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.22 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|