C16H13ClN4O3 — CID 111476946
1-(3-chlorophenyl)-2-[3-(3-nitrophenyl)-1,2,4-triazol-1-yl]ethanol (PubChem CID 111476946) has the molecular formula C16H13ClN4O3 and a molecular weight of 344.76 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-2-[3-(3-nitrophenyl)-1,2,4-triazol-1-yl]ethanol.
| Compound Name | 1-(3-chlorophenyl)-2-[3-(3-nitrophenyl)-1,2,4-triazol-1-yl]ethanol |
|---|---|
| PubChem CID | 111476946 |
| Molecular Formula | C16H13ClN4O3 |
| Molecular Weight | 344.76 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | 1-(3-chlorophenyl)-2-[3-(3-nitrophenyl)-1,2,4-triazol-1-yl]ethanol |
| SMILES | O=[N+]([O-])c1cccc(-c2ncn(CC(O)c3cccc(Cl)c3)n2)c1 |
| InChI | InChI=1S/C16H13ClN4O3/c17-13-5-1-3-11(7-13)15(22)9-20-10-18-16(19-20)12-4-2-6-14(8-12)21(23)24/h1-8,10,15,22H,9H2 |
| InChIKey | FZOSWGQEADEMGD-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 94.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.76 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|