C22H16ClN5O3S — CID 52873689
N-[2-(4-chlorophenyl)sulfanylphenyl]-2-[3-(3-nitrophenyl)-1,2,4-triazol-1-yl]acetamide (PubChem CID 52873689) has the molecular formula C22H16ClN5O3S and a molecular weight of 465.92 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)sulfanylphenyl]-2-[3-(3-nitrophenyl)-1,2,4-triazol-1-yl]acetamide.
| Compound Name | N-[2-(4-chlorophenyl)sulfanylphenyl]-2-[3-(3-nitrophenyl)-1,2,4-triazol-1-yl]acetamide |
|---|---|
| PubChem CID | 52873689 |
| Molecular Formula | C22H16ClN5O3S |
| Molecular Weight | 465.92 g/mol |
| Exact Mass | 465.07 |
| IUPAC Name | N-[2-(4-chlorophenyl)sulfanylphenyl]-2-[3-(3-nitrophenyl)-1,2,4-triazol-1-yl]acetamide |
| SMILES | O=C(Cn1cnc(-c2cccc([N+](=O)[O-])c2)n1)Nc1ccccc1Sc1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H16ClN5O3S/c23-16-8-10-18(11-9-16)32-20-7-2-1-6-19(20)25-21(29)13-27-14-24-22(26-27)15-4-3-5-17(12-15)28(30)31/h1-12,14H,13H2,(H,25,29) |
| InChIKey | QCZYBLGHOKGFGO-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.92 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|