C18H14Cl2N4O3S — CID 19529280
2-(4-chloro-5-methyl-3-nitropyrazol-1-yl)-N-[2-(4-chlorophenyl)sulfanylphenyl]acetamide (PubChem CID 19529280) has the molecular formula C18H14Cl2N4O3S and a molecular weight of 437.31 g/mol. Its IUPAC name is 2-(4-chloro-5-methyl-3-nitropyrazol-1-yl)-N-[2-(4-chlorophenyl)sulfanylphenyl]acetamide.
| Compound Name | 2-(4-chloro-5-methyl-3-nitropyrazol-1-yl)-N-[2-(4-chlorophenyl)sulfanylphenyl]acetamide |
|---|---|
| PubChem CID | 19529280 |
| Molecular Formula | C18H14Cl2N4O3S |
| Molecular Weight | 437.31 g/mol |
| Exact Mass | 436.02 |
| IUPAC Name | 2-(4-chloro-5-methyl-3-nitropyrazol-1-yl)-N-[2-(4-chlorophenyl)sulfanylphenyl]acetamide |
| SMILES | Cc1c(Cl)c([N+](=O)[O-])nn1CC(=O)Nc1ccccc1Sc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H14Cl2N4O3S/c1-11-17(20)18(24(26)27)22-23(11)10-16(25)21-14-4-2-3-5-15(14)28-13-8-6-12(19)7-9-13/h2-9H,10H2,1H3,(H,21,25) |
| InChIKey | KNDCDLQXVSIELN-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.31 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|