C12H12N4O3 — CID 113231123
1-[3-(3-nitrophenyl)-1,2,4-triazol-1-yl]butan-2-one (PubChem CID 113231123) has the molecular formula C12H12N4O3 and a molecular weight of 260.25 g/mol. Its IUPAC name is 1-[3-(3-nitrophenyl)-1,2,4-triazol-1-yl]butan-2-one.
| Compound Name | 1-[3-(3-nitrophenyl)-1,2,4-triazol-1-yl]butan-2-one |
|---|---|
| PubChem CID | 113231123 |
| Molecular Formula | C12H12N4O3 |
| Molecular Weight | 260.25 g/mol |
| Exact Mass | 260.09 |
| IUPAC Name | 1-[3-(3-nitrophenyl)-1,2,4-triazol-1-yl]butan-2-one |
| SMILES | CCC(=O)Cn1cnc(-c2cccc([N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C12H12N4O3/c1-2-11(17)7-15-8-13-12(14-15)9-4-3-5-10(6-9)16(18)19/h3-6,8H,2,7H2,1H3 |
| InChIKey | KKZGXDDKSJHCLQ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 90.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.25 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|