C10H7N5O5 — CID 62023816
1-(3-nitrophenyl)-2-(3-nitro-1,2,4-triazol-1-yl)ethanone (PubChem CID 62023816) has the molecular formula C10H7N5O5 and a molecular weight of 277.20 g/mol. Its IUPAC name is 1-(3-nitrophenyl)-2-(3-nitro-1,2,4-triazol-1-yl)ethanone.
| Compound Name | 1-(3-nitrophenyl)-2-(3-nitro-1,2,4-triazol-1-yl)ethanone |
|---|---|
| PubChem CID | 62023816 |
| Molecular Formula | C10H7N5O5 |
| Molecular Weight | 277.20 g/mol |
| Exact Mass | 277.04 |
| IUPAC Name | 1-(3-nitrophenyl)-2-(3-nitro-1,2,4-triazol-1-yl)ethanone |
| SMILES | O=C(Cn1cnc([N+](=O)[O-])n1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C10H7N5O5/c16-9(5-13-6-11-10(12-13)15(19)20)7-2-1-3-8(4-7)14(17)18/h1-4,6H,5H2 |
| InChIKey | APTKULQEOVVHNO-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 134.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.20 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|