C11H9BrN4O4 — CID 47290066
1-(3-bromo-4-methoxyphenyl)-2-(3-nitro-1,2,4-triazol-1-yl)ethanone (PubChem CID 47290066) has the molecular formula C11H9BrN4O4 and a molecular weight of 341.12 g/mol. Its IUPAC name is 1-(3-bromo-4-methoxyphenyl)-2-(3-nitro-1,2,4-triazol-1-yl)ethanone.
| Compound Name | 1-(3-bromo-4-methoxyphenyl)-2-(3-nitro-1,2,4-triazol-1-yl)ethanone |
|---|---|
| PubChem CID | 47290066 |
| Molecular Formula | C11H9BrN4O4 |
| Molecular Weight | 341.12 g/mol |
| Exact Mass | 339.98 |
| IUPAC Name | 1-(3-bromo-4-methoxyphenyl)-2-(3-nitro-1,2,4-triazol-1-yl)ethanone |
| SMILES | COc1ccc(C(=O)Cn2cnc([N+](=O)[O-])n2)cc1Br |
| InChI | InChI=1S/C11H9BrN4O4/c1-20-10-3-2-7(4-8(10)12)9(17)5-15-6-13-11(14-15)16(18)19/h2-4,6H,5H2,1H3 |
| InChIKey | VCZDSWGUVHABKF-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 100.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.12 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|