C10H9BrN6O3 — CID 102774820
3-bromo-4-[(3-nitro-1,2,4-triazol-1-yl)methyl]benzohydrazide (PubChem CID 102774820) has the molecular formula C10H9BrN6O3 and a molecular weight of 341.13 g/mol. Its IUPAC name is 3-bromo-4-[(3-nitro-1,2,4-triazol-1-yl)methyl]benzohydrazide.
| Compound Name | 3-bromo-4-[(3-nitro-1,2,4-triazol-1-yl)methyl]benzohydrazide |
|---|---|
| PubChem CID | 102774820 |
| Molecular Formula | C10H9BrN6O3 |
| Molecular Weight | 341.13 g/mol |
| Exact Mass | 339.99 |
| IUPAC Name | 3-bromo-4-[(3-nitro-1,2,4-triazol-1-yl)methyl]benzohydrazide |
| SMILES | NNC(=O)c1ccc(Cn2cnc([N+](=O)[O-])n2)c(Br)c1 |
| InChI | InChI=1S/C10H9BrN6O3/c11-8-3-6(9(18)14-12)1-2-7(8)4-16-5-13-10(15-16)17(19)20/h1-3,5H,4,12H2,(H,14,18) |
| InChIKey | ZVUGHVMPCKXNIL-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 128.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.13 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|