C13H14BrClN4O — CID 102774824
3-bromo-4-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]benzohydrazide (PubChem CID 102774824) has the molecular formula C13H14BrClN4O and a molecular weight of 357.64 g/mol. Its IUPAC name is 3-bromo-4-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]benzohydrazide.
| Compound Name | 3-bromo-4-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]benzohydrazide |
|---|---|
| PubChem CID | 102774824 |
| Molecular Formula | C13H14BrClN4O |
| Molecular Weight | 357.64 g/mol |
| Exact Mass | 356.00 |
| IUPAC Name | 3-bromo-4-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]benzohydrazide |
| SMILES | Cc1nn(Cc2ccc(C(=O)NN)cc2Br)c(C)c1Cl |
| InChI | InChI=1S/C13H14BrClN4O/c1-7-12(15)8(2)19(18-7)6-10-4-3-9(5-11(10)14)13(20)17-16/h3-5H,6,16H2,1-2H3,(H,17,20) |
| InChIKey | BPWPCFXBUUBFLI-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.64 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|