C14H17ClN4O2 — CID 63577103
4-[2-(4-chloro-3,5-dimethylpyrazol-1-yl)ethoxy]benzohydrazide (PubChem CID 63577103) has the molecular formula C14H17ClN4O2 and a molecular weight of 308.77 g/mol. Its IUPAC name is 4-[2-(4-chloro-3,5-dimethylpyrazol-1-yl)ethoxy]benzohydrazide.
| Compound Name | 4-[2-(4-chloro-3,5-dimethylpyrazol-1-yl)ethoxy]benzohydrazide |
|---|---|
| PubChem CID | 63577103 |
| Molecular Formula | C14H17ClN4O2 |
| Molecular Weight | 308.77 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | 4-[2-(4-chloro-3,5-dimethylpyrazol-1-yl)ethoxy]benzohydrazide |
| SMILES | Cc1nn(CCOc2ccc(C(=O)NN)cc2)c(C)c1Cl |
| InChI | InChI=1S/C14H17ClN4O2/c1-9-13(15)10(2)19(18-9)7-8-21-12-5-3-11(4-6-12)14(20)17-16/h3-6H,7-8,16H2,1-2H3,(H,17,20) |
| InChIKey | XSCLSUZHMKBVIW-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.77 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|