C8H5BrN4O3S — CID 60975117
1-(5-bromothiophen-2-yl)-2-(3-nitro-1,2,4-triazol-1-yl)ethanone (PubChem CID 60975117) has the molecular formula C8H5BrN4O3S and a molecular weight of 317.12 g/mol. Its IUPAC name is 1-(5-bromothiophen-2-yl)-2-(3-nitro-1,2,4-triazol-1-yl)ethanone.
| Compound Name | 1-(5-bromothiophen-2-yl)-2-(3-nitro-1,2,4-triazol-1-yl)ethanone |
|---|---|
| PubChem CID | 60975117 |
| Molecular Formula | C8H5BrN4O3S |
| Molecular Weight | 317.12 g/mol |
| Exact Mass | 315.93 |
| IUPAC Name | 1-(5-bromothiophen-2-yl)-2-(3-nitro-1,2,4-triazol-1-yl)ethanone |
| SMILES | O=C(Cn1cnc([N+](=O)[O-])n1)c1ccc(Br)s1 |
| InChI | InChI=1S/C8H5BrN4O3S/c9-7-2-1-6(17-7)5(14)3-12-4-10-8(11-12)13(15)16/h1-2,4H,3H2 |
| InChIKey | HBFHRCVLJRFEMU-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 90.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.12 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|