C11H10N4O3 — CID 62024552
1-(3-methylphenyl)-2-(3-nitro-1,2,4-triazol-1-yl)ethanone (PubChem CID 62024552) has the molecular formula C11H10N4O3 and a molecular weight of 246.23 g/mol. Its IUPAC name is 1-(3-methylphenyl)-2-(3-nitro-1,2,4-triazol-1-yl)ethanone.
| Compound Name | 1-(3-methylphenyl)-2-(3-nitro-1,2,4-triazol-1-yl)ethanone |
|---|---|
| PubChem CID | 62024552 |
| Molecular Formula | C11H10N4O3 |
| Molecular Weight | 246.23 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | 1-(3-methylphenyl)-2-(3-nitro-1,2,4-triazol-1-yl)ethanone |
| SMILES | Cc1cccc(C(=O)Cn2cnc([N+](=O)[O-])n2)c1 |
| InChI | InChI=1S/C11H10N4O3/c1-8-3-2-4-9(5-8)10(16)6-14-7-12-11(13-14)15(17)18/h2-5,7H,6H2,1H3 |
| InChIKey | OILQDLZFAOZEBY-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 90.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.23 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|